C18H20N4S — CID 166247279
2-[4-[4-(piperidin-1-ylmethyl)phenyl]pyrazol-1-yl]-1,3-thiazole (PubChem CID 166247279) has the molecular formula C18H20N4S and a molecular weight of 324.45 g/mol. Its IUPAC name is 2-[4-[4-(piperidin-1-ylmethyl)phenyl]pyrazol-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-[4-(piperidin-1-ylmethyl)phenyl]pyrazol-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 166247279 |
| Molecular Formula | C18H20N4S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-[4-[4-(piperidin-1-ylmethyl)phenyl]pyrazol-1-yl]-1,3-thiazole |
| SMILES | c1csc(-n2cc(-c3ccc(CN4CCCCC4)cc3)cn2)n1 |
| InChI | InChI=1S/C18H20N4S/c1-2-9-21(10-3-1)13-15-4-6-16(7-5-15)17-12-20-22(14-17)18-19-8-11-23-18/h4-8,11-12,14H,1-3,9-10,13H2 |
| InChIKey | QOWILCBOGZBIHP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |