C16H21N3OS — CID 82152217
2-(2-piperidin-1-ylethoxy)-5-(1,3-thiazol-2-yl)aniline (PubChem CID 82152217) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 2-(2-piperidin-1-ylethoxy)-5-(1,3-thiazol-2-yl)aniline.
| Compound Name | 2-(2-piperidin-1-ylethoxy)-5-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 82152217 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-(2-piperidin-1-ylethoxy)-5-(1,3-thiazol-2-yl)aniline |
| SMILES | Nc1cc(-c2nccs2)ccc1OCCN1CCCCC1 |
| InChI | InChI=1S/C16H21N3OS/c17-14-12-13(16-18-6-11-21-16)4-5-15(14)20-10-9-19-7-2-1-3-8-19/h4-6,11-12H,1-3,7-10,17H2 |
| InChIKey | QSUXPUJIQFNGQH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|