C18H18N2OS — CID 94758847
2-(3-phenylpropoxy)-5-(1,3-thiazol-2-yl)aniline (PubChem CID 94758847) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-(3-phenylpropoxy)-5-(1,3-thiazol-2-yl)aniline.
| Compound Name | 2-(3-phenylpropoxy)-5-(1,3-thiazol-2-yl)aniline |
|---|---|
| PubChem CID | 94758847 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 2-(3-phenylpropoxy)-5-(1,3-thiazol-2-yl)aniline |
| SMILES | Nc1cc(-c2nccs2)ccc1OCCCc1ccccc1 |
| InChI | InChI=1S/C18H18N2OS/c19-16-13-15(18-20-10-12-22-18)8-9-17(16)21-11-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-10,12-13H,4,7,11,19H2 |
| InChIKey | AZDBFUZTXSXVPN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|