C17H14N2O4S2 — CID 55920700
methyl 4-[[3-(1,3-thiazol-2-yl)phenyl]sulfamoyl]benzoate (PubChem CID 55920700) has the molecular formula C17H14N2O4S2 and a molecular weight of 374.44 g/mol. Its IUPAC name is methyl 4-[[3-(1,3-thiazol-2-yl)phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-[[3-(1,3-thiazol-2-yl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 55920700 |
| Molecular Formula | C17H14N2O4S2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | methyl 4-[[3-(1,3-thiazol-2-yl)phenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)Nc2cccc(-c3nccs3)c2)cc1 |
| InChI | InChI=1S/C17H14N2O4S2/c1-23-17(20)12-5-7-15(8-6-12)25(21,22)19-14-4-2-3-13(11-14)16-18-9-10-24-16/h2-11,19H,1H3 |
| InChIKey | KRWRTXWIWUCAMQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |