C18H16N2O5S2 — CID 52838954
methyl 4-[[3-(1,3-thiazol-4-ylmethoxy)phenyl]sulfamoyl]benzoate (PubChem CID 52838954) has the molecular formula C18H16N2O5S2 and a molecular weight of 404.47 g/mol. Its IUPAC name is methyl 4-[[3-(1,3-thiazol-4-ylmethoxy)phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-[[3-(1,3-thiazol-4-ylmethoxy)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 52838954 |
| Molecular Formula | C18H16N2O5S2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | methyl 4-[[3-(1,3-thiazol-4-ylmethoxy)phenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)Nc2cccc(OCc3cscn3)c2)cc1 |
| InChI | InChI=1S/C18H16N2O5S2/c1-24-18(21)13-5-7-17(8-6-13)27(22,23)20-14-3-2-4-16(9-14)25-10-15-11-26-12-19-15/h2-9,11-12,20H,10H2,1H3 |
| InChIKey | XGSUKXLSOIMEBO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |