C15H17N3O2S — CID 60615827
N-[3-(1,3-thiazol-4-ylmethoxy)phenyl]pyrrolidine-1-carboxamide (PubChem CID 60615827) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is N-[3-(1,3-thiazol-4-ylmethoxy)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[3-(1,3-thiazol-4-ylmethoxy)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 60615827 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | N-[3-(1,3-thiazol-4-ylmethoxy)phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(OCc2cscn2)c1)N1CCCC1 |
| InChI | InChI=1S/C15H17N3O2S/c19-15(18-6-1-2-7-18)17-12-4-3-5-14(8-12)20-9-13-10-21-11-16-13/h3-5,8,10-11H,1-2,6-7,9H2,(H,17,19) |
| InChIKey | MXTJBUAVXRECCN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |