C21H25N5O4S — CID 56567793
4-(2-oxo-2-pyrrolidin-1-ylacetyl)-N-[3-(1,3-thiazol-4-ylmethoxy)phenyl]piperazine-1-carboxamide (PubChem CID 56567793) has the molecular formula C21H25N5O4S and a molecular weight of 443.53 g/mol. Its IUPAC name is 4-(2-oxo-2-pyrrolidin-1-ylacetyl)-N-[3-(1,3-thiazol-4-ylmethoxy)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-oxo-2-pyrrolidin-1-ylacetyl)-N-[3-(1,3-thiazol-4-ylmethoxy)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 56567793 |
| Molecular Formula | C21H25N5O4S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 4-(2-oxo-2-pyrrolidin-1-ylacetyl)-N-[3-(1,3-thiazol-4-ylmethoxy)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1cccc(OCc2cscn2)c1)N1CCN(C(=O)C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C21H25N5O4S/c27-19(24-6-1-2-7-24)20(28)25-8-10-26(11-9-25)21(29)23-16-4-3-5-18(12-16)30-13-17-14-31-15-22-17/h3-5,12,14-15H,1-2,6-11,13H2,(H,23,29) |
| InChIKey | XDKVQJHLXIHMQI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|