C17H22N4O4S2 — CID 56568082
1-(1-methylsulfonylpiperidin-3-yl)-3-[3-(1,3-thiazol-4-ylmethoxy)phenyl]urea (PubChem CID 56568082) has the molecular formula C17H22N4O4S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-(1-methylsulfonylpiperidin-3-yl)-3-[3-(1,3-thiazol-4-ylmethoxy)phenyl]urea.
| Compound Name | 1-(1-methylsulfonylpiperidin-3-yl)-3-[3-(1,3-thiazol-4-ylmethoxy)phenyl]urea |
|---|---|
| PubChem CID | 56568082 |
| Molecular Formula | C17H22N4O4S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 1-(1-methylsulfonylpiperidin-3-yl)-3-[3-(1,3-thiazol-4-ylmethoxy)phenyl]urea |
| SMILES | CS(=O)(=O)N1CCCC(NC(=O)Nc2cccc(OCc3cscn3)c2)C1 |
| InChI | InChI=1S/C17H22N4O4S2/c1-27(23,24)21-7-3-5-14(9-21)20-17(22)19-13-4-2-6-16(8-13)25-10-15-11-26-12-18-15/h2,4,6,8,11-12,14H,3,5,7,9-10H2,1H3,(H2,19,20,22) |
| InChIKey | GVVUIBGFURQVKN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |