C21H19N3O3S — CID 46568531
N-[3-(cyclopropanecarbonylamino)phenyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 46568531) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is N-[3-(cyclopropanecarbonylamino)phenyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | N-[3-(cyclopropanecarbonylamino)phenyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 46568531 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[3-(cyclopropanecarbonylamino)phenyl]-3-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | O=C(Nc1cccc(NC(=O)C2CC2)c1)c1cccc(OCc2cscn2)c1 |
| InChI | InChI=1S/C21H19N3O3S/c25-20(14-7-8-14)23-16-4-2-5-17(10-16)24-21(26)15-3-1-6-19(9-15)27-11-18-12-28-13-22-18/h1-6,9-10,12-14H,7-8,11H2,(H,23,25)(H,24,26) |
| InChIKey | GINIQCLUGSUTQK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |