C13H11N3O2S3 — CID 61300199
4-amino-N-[3-(1,3-thiazol-2-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 61300199) has the molecular formula C13H11N3O2S3 and a molecular weight of 337.45 g/mol. Its IUPAC name is 4-amino-N-[3-(1,3-thiazol-2-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-[3-(1,3-thiazol-2-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61300199 |
| Molecular Formula | C13H11N3O2S3 |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 4-amino-N-[3-(1,3-thiazol-2-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | Nc1csc(S(=O)(=O)Nc2cccc(-c3nccs3)c2)c1 |
| InChI | InChI=1S/C13H11N3O2S3/c14-10-7-12(20-8-10)21(17,18)16-11-3-1-2-9(6-11)13-15-4-5-19-13/h1-8,16H,14H2 |
| InChIKey | XIKKFQLBSWFDIC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |