C12H13N3O4S2 — CID 61299815
methyl N-[3-[(4-aminothiophen-2-yl)sulfonylamino]phenyl]carbamate (PubChem CID 61299815) has the molecular formula C12H13N3O4S2 and a molecular weight of 327.39 g/mol. Its IUPAC name is methyl N-[3-[(4-aminothiophen-2-yl)sulfonylamino]phenyl]carbamate.
| Compound Name | methyl N-[3-[(4-aminothiophen-2-yl)sulfonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 61299815 |
| Molecular Formula | C12H13N3O4S2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | methyl N-[3-[(4-aminothiophen-2-yl)sulfonylamino]phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(NS(=O)(=O)c2cc(N)cs2)c1 |
| InChI | InChI=1S/C12H13N3O4S2/c1-19-12(16)14-9-3-2-4-10(6-9)15-21(17,18)11-5-8(13)7-20-11/h2-7,15H,13H2,1H3,(H,14,16) |
| InChIKey | IXAPCPDGZKCBMH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |