C12H8N4O2S2 — CID 107786924
4-amino-N-(3,4-dicyanophenyl)thiophene-2-sulfonamide (PubChem CID 107786924) has the molecular formula C12H8N4O2S2 and a molecular weight of 304.36 g/mol. Its IUPAC name is 4-amino-N-(3,4-dicyanophenyl)thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-(3,4-dicyanophenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 107786924 |
| Molecular Formula | C12H8N4O2S2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 4-amino-N-(3,4-dicyanophenyl)thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)c2cc(N)cs2)cc1C#N |
| InChI | InChI=1S/C12H8N4O2S2/c13-5-8-1-2-11(3-9(8)6-14)16-20(17,18)12-4-10(15)7-19-12/h1-4,7,16H,15H2 |
| InChIKey | BXXDPAPXPMSMIU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |