C13H14N2O4S2 — CID 106909778
4-amino-N-[4-(1,3-dioxolan-2-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 106909778) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-amino-N-[4-(1,3-dioxolan-2-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-[4-(1,3-dioxolan-2-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106909778 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 4-amino-N-[4-(1,3-dioxolan-2-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | Nc1csc(S(=O)(=O)Nc2ccc(C3OCCO3)cc2)c1 |
| InChI | InChI=1S/C13H14N2O4S2/c14-10-7-12(20-8-10)21(16,17)15-11-3-1-9(2-4-11)13-18-5-6-19-13/h1-4,7-8,13,15H,5-6,14H2 |
| InChIKey | IMLLMICCJRGUTQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |