C13H9N5O2S — CID 107793321
4-amino-N-(3,4-dicyanophenyl)pyridine-3-sulfonamide (PubChem CID 107793321) has the molecular formula C13H9N5O2S and a molecular weight of 299.32 g/mol. Its IUPAC name is 4-amino-N-(3,4-dicyanophenyl)pyridine-3-sulfonamide.
| Compound Name | 4-amino-N-(3,4-dicyanophenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107793321 |
| Molecular Formula | C13H9N5O2S |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 4-amino-N-(3,4-dicyanophenyl)pyridine-3-sulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)c2cnccc2N)cc1C#N |
| InChI | InChI=1S/C13H9N5O2S/c14-6-9-1-2-11(5-10(9)7-15)18-21(19,20)13-8-17-4-3-12(13)16/h1-5,8,18H,(H2,16,17) |
| InChIKey | YHFTYWYYPABOTM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 132.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |