C23H17N9O3 — CID 135939450
3-[[4-anilino-6-(4-nitroanilino)-1,3,5-triazin-2-yl]diazenyl]-1H-indol-2-ol (PubChem CID 135939450) has the molecular formula C23H17N9O3 and a molecular weight of 467.45 g/mol. Its IUPAC name is 3-[[4-anilino-6-(4-nitroanilino)-1,3,5-triazin-2-yl]diazenyl]-1H-indol-2-ol.
| Compound Name | 3-[[4-anilino-6-(4-nitroanilino)-1,3,5-triazin-2-yl]diazenyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 135939450 |
| Molecular Formula | C23H17N9O3 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 3-[[4-anilino-6-(4-nitroanilino)-1,3,5-triazin-2-yl]diazenyl]-1H-indol-2-ol |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc(/N=N/c3c(O)[nH]c4ccccc34)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H17N9O3/c33-20-19(17-8-4-5-9-18(17)26-20)30-31-23-28-21(24-14-6-2-1-3-7-14)27-22(29-23)25-15-10-12-16(13-11-15)32(34)35/h1-13,26,33H,(H2,24,25,27,28,29)/b31-30+ |
| InChIKey | YUJZDVXDVKXLCG-NVQSTNCTSA-N |
| XLogP | 5.87 |
| TPSA | 166.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|