C23H17BrN8O — CID 137117422
5-bromo-3-[(4,6-dianilino-1,3,5-triazin-2-yl)diazenyl]-1H-indol-2-ol (PubChem CID 137117422) has the molecular formula C23H17BrN8O and a molecular weight of 501.35 g/mol. Its IUPAC name is 5-bromo-3-[(4,6-dianilino-1,3,5-triazin-2-yl)diazenyl]-1H-indol-2-ol.
| Compound Name | 5-bromo-3-[(4,6-dianilino-1,3,5-triazin-2-yl)diazenyl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 137117422 |
| Molecular Formula | C23H17BrN8O |
| Molecular Weight | 501.35 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | 5-bromo-3-[(4,6-dianilino-1,3,5-triazin-2-yl)diazenyl]-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccc(Br)cc2c1/N=N/c1nc(Nc2ccccc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C23H17BrN8O/c24-14-11-12-18-17(13-14)19(20(33)27-18)31-32-23-29-21(25-15-7-3-1-4-8-15)28-22(30-23)26-16-9-5-2-6-10-16/h1-13,27,33H,(H2,25,26,28,29,30)/b32-31+ |
| InChIKey | XBKBMPVODFLNCT-QNEJGDQOSA-N |
| XLogP | 6.72 |
| TPSA | 123.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.35 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|