C24H18N6O — CID 135818199
3-[(5,6-diphenyl-1,2,4-triazin-3-yl)diazenyl]-5-methyl-1H-indol-2-ol (PubChem CID 135818199) has the molecular formula C24H18N6O and a molecular weight of 406.45 g/mol. Its IUPAC name is 3-[(5,6-diphenyl-1,2,4-triazin-3-yl)diazenyl]-5-methyl-1H-indol-2-ol.
| Compound Name | 3-[(5,6-diphenyl-1,2,4-triazin-3-yl)diazenyl]-5-methyl-1H-indol-2-ol |
|---|---|
| PubChem CID | 135818199 |
| Molecular Formula | C24H18N6O |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-[(5,6-diphenyl-1,2,4-triazin-3-yl)diazenyl]-5-methyl-1H-indol-2-ol |
| SMILES | Cc1ccc2[nH]c(O)c(/N=N/c3nnc(-c4ccccc4)c(-c4ccccc4)n3)c2c1 |
| InChI | InChI=1S/C24H18N6O/c1-15-12-13-19-18(14-15)22(23(31)25-19)28-30-24-26-20(16-8-4-2-5-9-16)21(27-29-24)17-10-6-3-7-11-17/h2-14,25,31H,1H3/b30-28+ |
| InChIKey | BXTPSUODSVQDFH-SJCQXOIGSA-N |
| XLogP | 6.12 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|