C12H9BrN4O2S — CID 135924717
(5R)-2-[(5-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]-5-methyl-1,3-thiazol-4-one (PubChem CID 135924717) has the molecular formula C12H9BrN4O2S and a molecular weight of 353.20 g/mol. Its IUPAC name is (5R)-2-[(5-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]-5-methyl-1,3-thiazol-4-one.
| Compound Name | (5R)-2-[(5-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]-5-methyl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 135924717 |
| Molecular Formula | C12H9BrN4O2S |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 351.96 |
| IUPAC Name | (5R)-2-[(5-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]-5-methyl-1,3-thiazol-4-one |
| SMILES | C[C@H]1SC(/N=N/c2c(O)[nH]c3ccc(Br)cc23)=NC1=O |
| InChI | InChI=1S/C12H9BrN4O2S/c1-5-10(18)15-12(20-5)17-16-9-7-4-6(13)2-3-8(7)14-11(9)19/h2-5,14,19H,1H3/b17-16+/t5-/m1/s1 |
| InChIKey | LLQBKRZPMJVHSO-UMWPYBIZSA-N |
| XLogP | 3.74 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|