C22H23BrN4O2 — CID 135922020
[4-[(5-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]phenyl]-(3,5-dimethylpiperidin-1-yl)methanone (PubChem CID 135922020) has the molecular formula C22H23BrN4O2 and a molecular weight of 455.36 g/mol. Its IUPAC name is [4-[(5-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]phenyl]-(3,5-dimethylpiperidin-1-yl)methanone.
| Compound Name | [4-[(5-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]phenyl]-(3,5-dimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 135922020 |
| Molecular Formula | C22H23BrN4O2 |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | [4-[(5-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]phenyl]-(3,5-dimethylpiperidin-1-yl)methanone |
| SMILES | CC1CC(C)CN(C(=O)c2ccc(/N=N/c3c(O)[nH]c4ccc(Br)cc34)cc2)C1 |
| InChI | InChI=1S/C22H23BrN4O2/c1-13-9-14(2)12-27(11-13)22(29)15-3-6-17(7-4-15)25-26-20-18-10-16(23)5-8-19(18)24-21(20)28/h3-8,10,13-14,24,28H,9,11-12H2,1-2H3/b26-25+ |
| InChIKey | MXGNROHQVFBNOD-OCEACIFDSA-N |
| XLogP | 6.17 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|