C26H22F2N4O3 — CID 135922027
[4-[(5-fluoro-2-hydroxy-1H-indol-3-yl)diazenyl]phenyl]-[2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]methanone (PubChem CID 135922027) has the molecular formula C26H22F2N4O3 and a molecular weight of 476.48 g/mol. Its IUPAC name is [4-[(5-fluoro-2-hydroxy-1H-indol-3-yl)diazenyl]phenyl]-[2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]methanone.
| Compound Name | [4-[(5-fluoro-2-hydroxy-1H-indol-3-yl)diazenyl]phenyl]-[2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 135922027 |
| Molecular Formula | C26H22F2N4O3 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | [4-[(5-fluoro-2-hydroxy-1H-indol-3-yl)diazenyl]phenyl]-[2-[(4-fluorophenoxy)methyl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(/N=N/c2c(O)[nH]c3ccc(F)cc23)cc1)N1CCCC1COc1ccc(F)cc1 |
| InChI | InChI=1S/C26H22F2N4O3/c27-17-5-10-21(11-6-17)35-15-20-2-1-13-32(20)26(34)16-3-8-19(9-4-16)30-31-24-22-14-18(28)7-12-23(22)29-25(24)33/h3-12,14,20,29,33H,1-2,13,15H2/b31-30+ |
| InChIKey | ZZIWFQSSTOISNJ-NVQSTNCTSA-N |
| XLogP | 6.25 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|