C24H28N2O4 — CID 92900487
[4-[[(2S)-1-(3-methylbenzoyl)pyrrolidin-2-yl]methoxy]phenyl]-morpholin-4-ylmethanone (PubChem CID 92900487) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is [4-[[(2S)-1-(3-methylbenzoyl)pyrrolidin-2-yl]methoxy]phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-[[(2S)-1-(3-methylbenzoyl)pyrrolidin-2-yl]methoxy]phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 92900487 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [4-[[(2S)-1-(3-methylbenzoyl)pyrrolidin-2-yl]methoxy]phenyl]-morpholin-4-ylmethanone |
| SMILES | Cc1cccc(C(=O)N2CCC[C@H]2COc2ccc(C(=O)N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C24H28N2O4/c1-18-4-2-5-20(16-18)24(28)26-11-3-6-21(26)17-30-22-9-7-19(8-10-22)23(27)25-12-14-29-15-13-25/h2,4-5,7-10,16,21H,3,6,11-15,17H2,1H3/t21-/m0/s1 |
| InChIKey | HOIKTLGHXFPZGH-NRFANRHFSA-N |
| XLogP | 3.15 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |