C24H34N2O4 — CID 163339484
3-cyclopentyl-1-[2-[[4-(morpholine-4-carbonyl)phenoxy]methyl]pyrrolidin-1-yl]propan-1-one (PubChem CID 163339484) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is 3-cyclopentyl-1-[2-[[4-(morpholine-4-carbonyl)phenoxy]methyl]pyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-cyclopentyl-1-[2-[[4-(morpholine-4-carbonyl)phenoxy]methyl]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 163339484 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 3-cyclopentyl-1-[2-[[4-(morpholine-4-carbonyl)phenoxy]methyl]pyrrolidin-1-yl]propan-1-one |
| SMILES | O=C(c1ccc(OCC2CCCN2C(=O)CCC2CCCC2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C24H34N2O4/c27-23(12-7-19-4-1-2-5-19)26-13-3-6-21(26)18-30-22-10-8-20(9-11-22)24(28)25-14-16-29-17-15-25/h8-11,19,21H,1-7,12-18H2 |
| InChIKey | MDLONCWDSKZSNC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |