C24H29N3O5 — CID 163340101
N-(2-methoxyphenyl)-2-[[4-(morpholine-4-carbonyl)phenoxy]methyl]pyrrolidine-1-carboxamide (PubChem CID 163340101) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-2-[[4-(morpholine-4-carbonyl)phenoxy]methyl]pyrrolidine-1-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-2-[[4-(morpholine-4-carbonyl)phenoxy]methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 163340101 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-(2-methoxyphenyl)-2-[[4-(morpholine-4-carbonyl)phenoxy]methyl]pyrrolidine-1-carboxamide |
| SMILES | COc1ccccc1NC(=O)N1CCCC1COc1ccc(C(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H29N3O5/c1-30-22-7-3-2-6-21(22)25-24(29)27-12-4-5-19(27)17-32-20-10-8-18(9-11-20)23(28)26-13-15-31-16-14-26/h2-3,6-11,19H,4-5,12-17H2,1H3,(H,25,29) |
| InChIKey | WOOYGHHHWANZFS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |