C23H25FN2O3 — CID 50846223
[4-[[1-(4-fluorobenzoyl)pyrrolidin-2-yl]methoxy]phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 50846223) has the molecular formula C23H25FN2O3 and a molecular weight of 396.46 g/mol. Its IUPAC name is [4-[[1-(4-fluorobenzoyl)pyrrolidin-2-yl]methoxy]phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-[[1-(4-fluorobenzoyl)pyrrolidin-2-yl]methoxy]phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 50846223 |
| Molecular Formula | C23H25FN2O3 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [4-[[1-(4-fluorobenzoyl)pyrrolidin-2-yl]methoxy]phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1ccc(OCC2CCCN2C(=O)c2ccc(F)cc2)cc1)N1CCCC1 |
| InChI | InChI=1S/C23H25FN2O3/c24-19-9-5-18(6-10-19)23(28)26-15-3-4-20(26)16-29-21-11-7-17(8-12-21)22(27)25-13-1-2-14-25/h5-12,20H,1-4,13-16H2 |
| InChIKey | SRMFDSGZHOIQEZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |