C15H13N7O2S — CID 135778147
5-[2-hydroxy-3-(1H-imidazol-2-yldiazenyl)-1H-indol-5-yl]-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one (PubChem CID 135778147) has the molecular formula C15H13N7O2S and a molecular weight of 355.38 g/mol. Its IUPAC name is 5-[2-hydroxy-3-(1H-imidazol-2-yldiazenyl)-1H-indol-5-yl]-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one.
| Compound Name | 5-[2-hydroxy-3-(1H-imidazol-2-yldiazenyl)-1H-indol-5-yl]-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one |
|---|---|
| PubChem CID | 135778147 |
| Molecular Formula | C15H13N7O2S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 5-[2-hydroxy-3-(1H-imidazol-2-yldiazenyl)-1H-indol-5-yl]-6-methyl-3,6-dihydro-1,3,4-thiadiazin-2-one |
| SMILES | CC1SC(=O)NN=C1c1ccc2[nH]c(O)c(/N=N/c3ncc[nH]3)c2c1 |
| InChI | InChI=1S/C15H13N7O2S/c1-7-11(19-22-15(24)25-7)8-2-3-10-9(6-8)12(13(23)18-10)20-21-14-16-4-5-17-14/h2-7,18,23H,1H3,(H,16,17)(H,22,24)/b21-20+ |
| InChIKey | FUWGXADRFSBNPW-QZQOTICOSA-N |
| XLogP | 3.56 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|