C20H17ClN4OS — CID 135624706
3-[[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]diazenyl]-5-ethyl-1H-indol-2-ol (PubChem CID 135624706) has the molecular formula C20H17ClN4OS and a molecular weight of 396.90 g/mol. Its IUPAC name is 3-[[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]diazenyl]-5-ethyl-1H-indol-2-ol.
| Compound Name | 3-[[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]diazenyl]-5-ethyl-1H-indol-2-ol |
|---|---|
| PubChem CID | 135624706 |
| Molecular Formula | C20H17ClN4OS |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 3-[[4-(4-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]diazenyl]-5-ethyl-1H-indol-2-ol |
| SMILES | CCc1ccc2[nH]c(O)c(/N=N/c3nc(-c4ccc(Cl)cc4)c(C)s3)c2c1 |
| InChI | InChI=1S/C20H17ClN4OS/c1-3-12-4-9-16-15(10-12)18(19(26)22-16)24-25-20-23-17(11(2)27-20)13-5-7-14(21)8-6-13/h4-10,22,26H,3H2,1-2H3/b25-24+ |
| InChIKey | PSJWWKHDEXTALA-OCOZRVBESA-N |
| XLogP | 6.94 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|