C21H15BrClN7O3 — CID 5168177
8-[(5-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(4-chlorophenyl)methyl]-3-methylpurine-2,6-dione (PubChem CID 5168177) has the molecular formula C21H15BrClN7O3 and a molecular weight of 528.75 g/mol. Its IUPAC name is 8-[(5-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(4-chlorophenyl)methyl]-3-methylpurine-2,6-dione.
| Compound Name | 8-[(5-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(4-chlorophenyl)methyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 5168177 |
| Molecular Formula | C21H15BrClN7O3 |
| Molecular Weight | 528.75 g/mol |
| Exact Mass | 527.01 |
| IUPAC Name | 8-[(5-bromo-2-hydroxy-1H-indol-3-yl)diazenyl]-7-[(4-chlorophenyl)methyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(/N=N/c1c(O)[nH]c3ccc(Br)cc13)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H15BrClN7O3/c1-29-17-16(19(32)26-21(29)33)30(9-10-2-5-12(23)6-3-10)20(25-17)28-27-15-13-8-11(22)4-7-14(13)24-18(15)31/h2-8,24,31H,9H2,1H3,(H,26,32,33)/b28-27+ |
| InChIKey | VBMUSQIVXOQSGJ-BYYHNAKLSA-N |
| XLogP | 4.49 |
| TPSA | 133.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.75 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|