C16H12N6O3S — CID 139236509
1-[(2-hydroxy-1H-indol-3-yl)imino]-3-[(E)-(3-nitrophenyl)methylideneamino]thiourea (PubChem CID 139236509) has the molecular formula C16H12N6O3S and a molecular weight of 368.38 g/mol. Its IUPAC name is 1-[(2-hydroxy-1H-indol-3-yl)imino]-3-[(E)-(3-nitrophenyl)methylideneamino]thiourea.
| Compound Name | 1-[(2-hydroxy-1H-indol-3-yl)imino]-3-[(E)-(3-nitrophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 139236509 |
| Molecular Formula | C16H12N6O3S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 1-[(2-hydroxy-1H-indol-3-yl)imino]-3-[(E)-(3-nitrophenyl)methylideneamino]thiourea |
| SMILES | O=[N+]([O-])c1cccc(/C=N/NC(=S)/N=N/c2c(O)[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C16H12N6O3S/c23-15-14(12-6-1-2-7-13(12)18-15)19-21-16(26)20-17-9-10-4-3-5-11(8-10)22(24)25/h1-9,18,23H,(H,20,26)/b17-9+,21-19+ |
| InChIKey | ZRUFRBAUUCZTBH-ZDYCKTBTSA-N |
| XLogP | 3.77 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|