C11H9IN2O4S — CID 112750092
3-iodo-5-(1H-pyrrol-3-ylsulfonylamino)benzoic acid (PubChem CID 112750092) has the molecular formula C11H9IN2O4S and a molecular weight of 392.17 g/mol. Its IUPAC name is 3-iodo-5-(1H-pyrrol-3-ylsulfonylamino)benzoic acid.
| Compound Name | 3-iodo-5-(1H-pyrrol-3-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 112750092 |
| Molecular Formula | C11H9IN2O4S |
| Molecular Weight | 392.17 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | 3-iodo-5-(1H-pyrrol-3-ylsulfonylamino)benzoic acid |
| SMILES | O=C(O)c1cc(I)cc(NS(=O)(=O)c2cc[nH]c2)c1 |
| InChI | InChI=1S/C11H9IN2O4S/c12-8-3-7(11(15)16)4-9(5-8)14-19(17,18)10-1-2-13-6-10/h1-6,13-14H,(H,15,16) |
| InChIKey | KZDCNBPERQKCBA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.17 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|