C17H11NO7S — CID 167982983
3-(furan-3-ylsulfonylamino)dibenzo-p-dioxin-1-carboxylic acid (PubChem CID 167982983) has the molecular formula C17H11NO7S and a molecular weight of 373.34 g/mol. Its IUPAC name is 3-(furan-3-ylsulfonylamino)dibenzo-p-dioxin-1-carboxylic acid.
| Compound Name | 3-(furan-3-ylsulfonylamino)dibenzo-p-dioxin-1-carboxylic acid |
|---|---|
| PubChem CID | 167982983 |
| Molecular Formula | C17H11NO7S |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 3-(furan-3-ylsulfonylamino)dibenzo-p-dioxin-1-carboxylic acid |
| SMILES | O=C(O)c1cc(NS(=O)(=O)c2ccoc2)cc2c1Oc1ccccc1O2 |
| InChI | InChI=1S/C17H11NO7S/c19-17(20)12-7-10(18-26(21,22)11-5-6-23-9-11)8-15-16(12)25-14-4-2-1-3-13(14)24-15/h1-9,18H,(H,19,20) |
| InChIKey | AMCSPRPTAICJFF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |