C20H10F5NO6S — CID 167920096
methyl 3-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]dibenzo-p-dioxin-1-carboxylate (PubChem CID 167920096) has the molecular formula C20H10F5NO6S and a molecular weight of 487.36 g/mol. Its IUPAC name is methyl 3-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]dibenzo-p-dioxin-1-carboxylate.
| Compound Name | methyl 3-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]dibenzo-p-dioxin-1-carboxylate |
|---|---|
| PubChem CID | 167920096 |
| Molecular Formula | C20H10F5NO6S |
| Molecular Weight | 487.36 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | methyl 3-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]dibenzo-p-dioxin-1-carboxylate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)cc2c1Oc1ccccc1O2 |
| InChI | InChI=1S/C20H10F5NO6S/c1-30-20(27)9-6-8(7-12-18(9)32-11-5-3-2-4-10(11)31-12)26-33(28,29)19-16(24)14(22)13(21)15(23)17(19)25/h2-7,26H,1H3 |
| InChIKey | GTHVFQOVNPNGFF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|