C16H13F5NO5PS — CID 167925604
methyl 3-dimethylphosphoryl-4-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]benzoate (PubChem CID 167925604) has the molecular formula C16H13F5NO5PS and a molecular weight of 457.31 g/mol. Its IUPAC name is methyl 3-dimethylphosphoryl-4-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]benzoate.
| Compound Name | methyl 3-dimethylphosphoryl-4-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 167925604 |
| Molecular Formula | C16H13F5NO5PS |
| Molecular Weight | 457.31 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | methyl 3-dimethylphosphoryl-4-[(2,3,4,5,6-pentafluorophenyl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1ccc(NS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c(P(C)(C)=O)c1 |
| InChI | InChI=1S/C16H13F5NO5PS/c1-27-16(23)7-4-5-8(9(6-7)28(2,3)24)22-29(25,26)15-13(20)11(18)10(17)12(19)14(15)21/h4-6,22H,1-3H3 |
| InChIKey | XXCSKNOVHDZEPJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|