C18H21NO5S2 — CID 119257865
3-methylsulfonyl-5-(6-thiophen-2-ylhexanoylamino)benzoic acid (PubChem CID 119257865) has the molecular formula C18H21NO5S2 and a molecular weight of 395.50 g/mol. Its IUPAC name is 3-methylsulfonyl-5-(6-thiophen-2-ylhexanoylamino)benzoic acid.
| Compound Name | 3-methylsulfonyl-5-(6-thiophen-2-ylhexanoylamino)benzoic acid |
|---|---|
| PubChem CID | 119257865 |
| Molecular Formula | C18H21NO5S2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 3-methylsulfonyl-5-(6-thiophen-2-ylhexanoylamino)benzoic acid |
| SMILES | CS(=O)(=O)c1cc(NC(=O)CCCCCc2cccs2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C18H21NO5S2/c1-26(23,24)16-11-13(18(21)22)10-14(12-16)19-17(20)8-4-2-3-6-15-7-5-9-25-15/h5,7,9-12H,2-4,6,8H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | YXJORUAWWBNUGX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|