C23H24N2O4S2 — CID 55961656
N-[(4-methylsulfonylphenyl)methyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide (PubChem CID 55961656) has the molecular formula C23H24N2O4S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[(4-methylsulfonylphenyl)methyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide.
| Compound Name | N-[(4-methylsulfonylphenyl)methyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 55961656 |
| Molecular Formula | C23H24N2O4S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | N-[(4-methylsulfonylphenyl)methyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide |
| SMILES | CS(=O)(=O)c1ccc(CNC(=O)c2cccc(NC(=O)CCCc3cccs3)c2)cc1 |
| InChI | InChI=1S/C23H24N2O4S2/c1-31(28,29)21-12-10-17(11-13-21)16-24-23(27)18-5-2-6-19(15-18)25-22(26)9-3-7-20-8-4-14-30-20/h2,4-6,8,10-15H,3,7,9,16H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | DKWWPQMDOLHCLB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |