C19H21N5O2S2 — CID 56577546
N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide (PubChem CID 56577546) has the molecular formula C19H21N5O2S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide.
| Compound Name | N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 56577546 |
| Molecular Formula | C19H21N5O2S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide |
| SMILES | Cn1c(CNC(=O)c2cccc(NC(=O)CCCc3cccs3)c2)n[nH]c1=S |
| InChI | InChI=1S/C19H21N5O2S2/c1-24-16(22-23-19(24)27)12-20-18(26)13-5-2-6-14(11-13)21-17(25)9-3-7-15-8-4-10-28-15/h2,4-6,8,10-11H,3,7,9,12H2,1H3,(H,20,26)(H,21,25)(H,23,27) |
| InChIKey | XZTQQNXKZBYIJN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|