C16H17N5O3S3 — CID 56543508
N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 56543508) has the molecular formula C16H17N5O3S3 and a molecular weight of 423.55 g/mol. Its IUPAC name is N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 56543508 |
| Molecular Formula | C16H17N5O3S3 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-3-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | Cn1c(CCNC(=O)c2cccc(NS(=O)(=O)c3cccs3)c2)n[nH]c1=S |
| InChI | InChI=1S/C16H17N5O3S3/c1-21-13(18-19-16(21)25)7-8-17-15(22)11-4-2-5-12(10-11)20-27(23,24)14-6-3-9-26-14/h2-6,9-10,20H,7-8H2,1H3,(H,17,22)(H,19,25) |
| InChIKey | YTUHAJDZIWLFFJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|