C20H23N5O3S2 — CID 56578076
2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide (PubChem CID 56578076) has the molecular formula C20H23N5O3S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide.
| Compound Name | 2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 56578076 |
| Molecular Formula | C20H23N5O3S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 2-methyl-5-[(3-methylphenyl)sulfamoyl]-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(C)c(C(=O)NCCc3n[nH]c(=S)n3C)c2)c1 |
| InChI | InChI=1S/C20H23N5O3S2/c1-13-5-4-6-15(11-13)24-30(27,28)16-8-7-14(2)17(12-16)19(26)21-10-9-18-22-23-20(29)25(18)3/h4-8,11-12,24H,9-10H2,1-3H3,(H,21,26)(H,23,29) |
| InChIKey | MKHVKBWYZXOVDI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|