C14H18ClN5O3S2 — CID 56536600
2-chloro-5-(dimethylsulfamoyl)-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide (PubChem CID 56536600) has the molecular formula C14H18ClN5O3S2 and a molecular weight of 403.92 g/mol. Its IUPAC name is 2-chloro-5-(dimethylsulfamoyl)-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide.
| Compound Name | 2-chloro-5-(dimethylsulfamoyl)-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 56536600 |
| Molecular Formula | C14H18ClN5O3S2 |
| Molecular Weight | 403.92 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 2-chloro-5-(dimethylsulfamoyl)-N-[2-(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(C(=O)NCCc2n[nH]c(=S)n2C)c1 |
| InChI | InChI=1S/C14H18ClN5O3S2/c1-19(2)25(22,23)9-4-5-11(15)10(8-9)13(21)16-7-6-12-17-18-14(24)20(12)3/h4-5,8H,6-7H2,1-3H3,(H,16,21)(H,18,24) |
| InChIKey | RTQOWPGRNGSCBY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.92 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|