C17H22ClN5O3S2 — CID 56562583
2-chloro-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 56562583) has the molecular formula C17H22ClN5O3S2 and a molecular weight of 443.98 g/mol. Its IUPAC name is 2-chloro-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 56562583 |
| Molecular Formula | C17H22ClN5O3S2 |
| Molecular Weight | 443.98 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 2-chloro-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CCn1c(CCNC(=O)c2cc(S(=O)(=O)N3CCCC3)ccc2Cl)n[nH]c1=S |
| InChI | InChI=1S/C17H22ClN5O3S2/c1-2-23-15(20-21-17(23)27)7-8-19-16(24)13-11-12(5-6-14(13)18)28(25,26)22-9-3-4-10-22/h5-6,11H,2-4,7-10H2,1H3,(H,19,24)(H,21,27) |
| InChIKey | NREVDACMLTUZBL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.98 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|