C17H23N5O3S2 — CID 56562296
5-(cyclopropylsulfamoyl)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2-methylbenzamide (PubChem CID 56562296) has the molecular formula C17H23N5O3S2 and a molecular weight of 409.54 g/mol. Its IUPAC name is 5-(cyclopropylsulfamoyl)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2-methylbenzamide.
| Compound Name | 5-(cyclopropylsulfamoyl)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 56562296 |
| Molecular Formula | C17H23N5O3S2 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 5-(cyclopropylsulfamoyl)-N-[2-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)ethyl]-2-methylbenzamide |
| SMILES | CCn1c(CCNC(=O)c2cc(S(=O)(=O)NC3CC3)ccc2C)n[nH]c1=S |
| InChI | InChI=1S/C17H23N5O3S2/c1-3-22-15(19-20-17(22)26)8-9-18-16(23)14-10-13(7-4-11(14)2)27(24,25)21-12-5-6-12/h4,7,10,12,21H,3,5-6,8-9H2,1-2H3,(H,18,23)(H,20,26) |
| InChIKey | CPPYPKRQXWRVMR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|