C17H25N5O3S2 — CID 56543559
5-(diethylsulfamoyl)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-methylbenzamide (PubChem CID 56543559) has the molecular formula C17H25N5O3S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-methylbenzamide.
| Compound Name | 5-(diethylsulfamoyl)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 56543559 |
| Molecular Formula | C17H25N5O3S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 5-(diethylsulfamoyl)-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-2-methylbenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(C(=O)NCc2n[nH]c(=S)n2CC)c1 |
| InChI | InChI=1S/C17H25N5O3S2/c1-5-21(6-2)27(24,25)13-9-8-12(4)14(10-13)16(23)18-11-15-19-20-17(26)22(15)7-3/h8-10H,5-7,11H2,1-4H3,(H,18,23)(H,20,26) |
| InChIKey | BBJIXOWLVBWREW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|