C16H24N6O4S2 — CID 56576175
2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]acetamide (PubChem CID 56576175) has the molecular formula C16H24N6O4S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]acetamide.
| Compound Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 56576175 |
| Molecular Formula | C16H24N6O4S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-[(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CC(=O)NCc2n[nH]c(=S)n2CC)c1 |
| InChI | InChI=1S/C16H24N6O4S2/c1-4-21(5-2)28(25,26)12-7-8-15(24)20(10-12)11-14(23)17-9-13-18-19-16(27)22(13)6-3/h7-8,10H,4-6,9,11H2,1-3H3,(H,17,23)(H,19,27) |
| InChIKey | AEEZBYLWZIHGQF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|