C16H15N5O4S2 — CID 56571363
5-methyl-4-[[3-(thiophen-2-ylsulfonylamino)benzoyl]amino]-1H-pyrazole-3-carboxamide (PubChem CID 56571363) has the molecular formula C16H15N5O4S2 and a molecular weight of 405.46 g/mol. Its IUPAC name is 5-methyl-4-[[3-(thiophen-2-ylsulfonylamino)benzoyl]amino]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-methyl-4-[[3-(thiophen-2-ylsulfonylamino)benzoyl]amino]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 56571363 |
| Molecular Formula | C16H15N5O4S2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 5-methyl-4-[[3-(thiophen-2-ylsulfonylamino)benzoyl]amino]-1H-pyrazole-3-carboxamide |
| SMILES | Cc1[nH]nc(C(N)=O)c1NC(=O)c1cccc(NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C16H15N5O4S2/c1-9-13(14(15(17)22)20-19-9)18-16(23)10-4-2-5-11(8-10)21-27(24,25)12-6-3-7-26-12/h2-8,21H,1H3,(H2,17,22)(H,18,23)(H,19,20) |
| InChIKey | GILXYTGKAPAKHJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 147.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |