C18H15FN2O3S2 — CID 55914376
N-(2-fluoro-4-methylphenyl)-3-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 55914376) has the molecular formula C18H15FN2O3S2 and a molecular weight of 390.46 g/mol. Its IUPAC name is N-(2-fluoro-4-methylphenyl)-3-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-(2-fluoro-4-methylphenyl)-3-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 55914376 |
| Molecular Formula | C18H15FN2O3S2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | N-(2-fluoro-4-methylphenyl)-3-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(NS(=O)(=O)c3cccs3)c2)c(F)c1 |
| InChI | InChI=1S/C18H15FN2O3S2/c1-12-7-8-16(15(19)10-12)20-18(22)13-4-2-5-14(11-13)21-26(23,24)17-6-3-9-25-17/h2-11,21H,1H3,(H,20,22) |
| InChIKey | LNMIXVOSIQOHKZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |