C19H26ClN3O2S — CID 119629762
N-(2-amino-2-methylpropyl)-3-(4-thiophen-2-ylbutanoylamino)benzamide;hydrochloride (PubChem CID 119629762) has the molecular formula C19H26ClN3O2S and a molecular weight of 395.96 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-3-(4-thiophen-2-ylbutanoylamino)benzamide;hydrochloride.
| Compound Name | N-(2-amino-2-methylpropyl)-3-(4-thiophen-2-ylbutanoylamino)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119629762 |
| Molecular Formula | C19H26ClN3O2S |
| Molecular Weight | 395.96 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-3-(4-thiophen-2-ylbutanoylamino)benzamide;hydrochloride |
| SMILES | CC(C)(N)CNC(=O)c1cccc(NC(=O)CCCc2cccs2)c1.Cl |
| InChI | InChI=1S/C19H25N3O2S.ClH/c1-19(2,20)13-21-18(24)14-6-3-7-15(12-14)22-17(23)10-4-8-16-9-5-11-25-16;/h3,5-7,9,11-12H,4,8,10,13,20H2,1-2H3,(H,21,24)(H,22,23);1H |
| InChIKey | VLAPUJYPVBZZPN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.96 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |