C24H33N3O2S — CID 55969629
N-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide (PubChem CID 55969629) has the molecular formula C24H33N3O2S and a molecular weight of 427.61 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide.
| Compound Name | N-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 55969629 |
| Molecular Formula | C24H33N3O2S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-[2-(3,5-dimethylpiperidin-1-yl)ethyl]-3-(4-thiophen-2-ylbutanoylamino)benzamide |
| SMILES | CC1CC(C)CN(CCNC(=O)c2cccc(NC(=O)CCCc3cccs3)c2)C1 |
| InChI | InChI=1S/C24H33N3O2S/c1-18-14-19(2)17-27(16-18)12-11-25-24(29)20-6-3-7-21(15-20)26-23(28)10-4-8-22-9-5-13-30-22/h3,5-7,9,13,15,18-19H,4,8,10-12,14,16-17H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | JHQKMOUEKMYCPA-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |