C21H19NO2S — CID 47092796
N-(3-benzoylphenyl)-4-thiophen-2-ylbutanamide (PubChem CID 47092796) has the molecular formula C21H19NO2S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-(3-benzoylphenyl)-4-thiophen-2-ylbutanamide.
| Compound Name | N-(3-benzoylphenyl)-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 47092796 |
| Molecular Formula | C21H19NO2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-(3-benzoylphenyl)-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCCc1cccs1)Nc1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H19NO2S/c23-20(13-5-11-19-12-6-14-25-19)22-18-10-4-9-17(15-18)21(24)16-7-2-1-3-8-16/h1-4,6-10,12,14-15H,5,11,13H2,(H,22,23) |
| InChIKey | USZOOWLBHYVKLE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |