C20H26ClN3O2S — CID 119376176
N-[3-(4-aminopiperidine-1-carbonyl)phenyl]-4-thiophen-2-ylbutanamide;hydrochloride (PubChem CID 119376176) has the molecular formula C20H26ClN3O2S and a molecular weight of 407.97 g/mol. Its IUPAC name is N-[3-(4-aminopiperidine-1-carbonyl)phenyl]-4-thiophen-2-ylbutanamide;hydrochloride.
| Compound Name | N-[3-(4-aminopiperidine-1-carbonyl)phenyl]-4-thiophen-2-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119376176 |
| Molecular Formula | C20H26ClN3O2S |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | N-[3-(4-aminopiperidine-1-carbonyl)phenyl]-4-thiophen-2-ylbutanamide;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)c2cccc(NC(=O)CCCc3cccs3)c2)CC1 |
| InChI | InChI=1S/C20H25N3O2S.ClH/c21-16-9-11-23(12-10-16)20(25)15-4-1-5-17(14-15)22-19(24)8-2-6-18-7-3-13-26-18;/h1,3-5,7,13-14,16H,2,6,8-12,21H2,(H,22,24);1H |
| InChIKey | AHGHJXOPBAFMHW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |