C23H24N2O2S2 — CID 55961487
4-thiophen-2-yl-N-[3-(2-thiophen-3-ylpyrrolidine-1-carbonyl)phenyl]butanamide (PubChem CID 55961487) has the molecular formula C23H24N2O2S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 4-thiophen-2-yl-N-[3-(2-thiophen-3-ylpyrrolidine-1-carbonyl)phenyl]butanamide.
| Compound Name | 4-thiophen-2-yl-N-[3-(2-thiophen-3-ylpyrrolidine-1-carbonyl)phenyl]butanamide |
|---|---|
| PubChem CID | 55961487 |
| Molecular Formula | C23H24N2O2S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 4-thiophen-2-yl-N-[3-(2-thiophen-3-ylpyrrolidine-1-carbonyl)phenyl]butanamide |
| SMILES | O=C(CCCc1cccs1)Nc1cccc(C(=O)N2CCCC2c2ccsc2)c1 |
| InChI | InChI=1S/C23H24N2O2S2/c26-22(10-2-7-20-8-4-13-29-20)24-19-6-1-5-17(15-19)23(27)25-12-3-9-21(25)18-11-14-28-16-18/h1,4-6,8,11,13-16,21H,2-3,7,9-10,12H2,(H,24,26) |
| InChIKey | HGYVOEIAHGSHKW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |