C26H26N4O2S — CID 55966656
N-[3-[2-(1H-benzimidazol-2-yl)pyrrolidine-1-carbonyl]phenyl]-4-thiophen-2-ylbutanamide (PubChem CID 55966656) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is N-[3-[2-(1H-benzimidazol-2-yl)pyrrolidine-1-carbonyl]phenyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[3-[2-(1H-benzimidazol-2-yl)pyrrolidine-1-carbonyl]phenyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 55966656 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-[3-[2-(1H-benzimidazol-2-yl)pyrrolidine-1-carbonyl]phenyl]-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCCc1cccs1)Nc1cccc(C(=O)N2CCCC2c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C26H26N4O2S/c31-24(14-4-9-20-10-6-16-33-20)27-19-8-3-7-18(17-19)26(32)30-15-5-13-23(30)25-28-21-11-1-2-12-22(21)29-25/h1-3,6-8,10-12,16-17,23H,4-5,9,13-15H2,(H,27,31)(H,28,29) |
| InChIKey | CNKWVUYZOLKMAB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |